C37H40N4O5 — CID 11650260
(E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-propoxyphenyl]prop-2-enoic acid (PubChem CID 11650260) has the molecular formula C37H40N4O5 and a molecular weight of 620.75 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-propoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-propoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11650260 |
| Molecular Formula | C37H40N4O5 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-propoxyphenyl]prop-2-enoic acid |
| SMILES | CCCOc1cc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccccn5)n(C)c4c3)CCC2)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C37H40N4O5/c1-3-21-46-31-23-27(15-12-24(31)14-17-32(42)43)39-36(45)37(18-8-19-37)40-35(44)26-13-16-28-30(22-26)41(2)34(29-11-6-7-20-38-29)33(28)25-9-4-5-10-25/h6-7,11-17,20,22-23,25H,3-5,8-10,18-19,21H2,1-2H3,(H,39,45)(H,40,44)(H,42,43)/b17-14+ |
| InChIKey | IVAHQLWEFRRXFT-SAPNQHFASA-N |
| XLogP | 7.08 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|