About 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane
2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane (PubChem CID 116502940) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane |
| PubChem CID | 116502940 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane |
| SMILES | COCC(C)C1NC(C)CCS1 |
| InChI | InChI=1S/C9H19NOS/c1-7(6-11-3)9-10-8(2)4-5-12-9/h7-10H,4-6H2,1-3H3 |
| InChIKey | PQCLNAXSVBADHR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane?
The IUPAC name of 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane (CID 116502940) is 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane.
What is the SMILES notation for 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane?
The canonical SMILES for 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane is COCC(C)C1NC(C)CCS1.
What is the InChIKey of 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane?
The InChIKey is PQCLNAXSVBADHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOS/c1-7(6-11-3)9-10-8(2)4-5-12-9/h7-10H,4-6H2,1-3H3.
What are the key properties of 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane?
2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane has a molecular weight of 189.32 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxypropan-2-yl)-4-methyl-1,3-thiazinane is sourced from PubChem (CID 116502940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).