C35H43N3O9 — CID 11650394
[(4E,6Z,10E)-19-benzamido-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 11650394) has the molecular formula C35H43N3O9 and a molecular weight of 649.74 g/mol. Its IUPAC name is [(4E,6Z,10E)-19-benzamido-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E)-19-benzamido-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 11650394 |
| Molecular Formula | C35H43N3O9 |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | [(4E,6Z,10E)-19-benzamido-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | COC1/C=C\C=C(/C)C(=O)NC2=CC(=O)C(NC(=O)c3ccccc3)=C(CC(C)CC(OC)C(O)C(C)/C=C(\C)C1OC(N)=O)C2=O |
| InChI | InChI=1S/C35H43N3O9/c1-19-15-24-29(38-34(43)23-12-8-7-9-13-23)26(39)18-25(31(24)41)37-33(42)20(2)11-10-14-27(45-5)32(47-35(36)44)22(4)17-21(3)30(40)28(16-19)46-6/h7-14,17-19,21,27-28,30,32,40H,15-16H2,1-6H3,(H2,36,44)(H,37,42)(H,38,43)/b14-10-,20-11+,22-17+ |
| InChIKey | QKVKJMPXDPCVPP-IYPKUAFBSA-N |
| XLogP | 3.19 |
| TPSA | 183.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|