C14H23BrN2S — CID 116504016
2-N-[(2-bromophenyl)methyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine (PubChem CID 116504016) has the molecular formula C14H23BrN2S and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-N-[(2-bromophenyl)methyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine.
| Compound Name | 2-N-[(2-bromophenyl)methyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 116504016 |
| Molecular Formula | C14H23BrN2S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-N-[(2-bromophenyl)methyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine |
| SMILES | CCSCCC(CN)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C14H23BrN2S/c1-3-18-9-8-13(10-16)17(2)11-12-6-4-5-7-14(12)15/h4-7,13H,3,8-11,16H2,1-2H3 |
| InChIKey | JAQZGKXZFOLAMI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|