C38H72N2O6 — CID 11650408
2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)butanedioic acid (PubChem CID 11650408) has the molecular formula C38H72N2O6 and a molecular weight of 653.00 g/mol. Its IUPAC name is 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)butanedioic acid.
| Compound Name | 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)butanedioic acid |
|---|---|
| PubChem CID | 11650408 |
| Molecular Formula | C38H72N2O6 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.54 |
| IUPAC Name | 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)butanedioic acid |
| SMILES | CCCCCCCCON1C(C)(C)CCC(C(CC(=O)O)(C(=O)O)C2CCC(C)(C)N(OCCCCCCCC)C2(C)C)C1(C)C |
| InChI | InChI=1S/C38H72N2O6/c1-11-13-15-17-19-21-27-45-39-34(3,4)25-23-30(36(39,7)8)38(33(43)44,29-32(41)42)31-24-26-35(5,6)40(37(31,9)10)46-28-22-20-18-16-14-12-2/h30-31H,11-29H2,1-10H3,(H,41,42)(H,43,44) |
| InChIKey | SUTDLPVGPCLIIV-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|