C11H24N2OS — CID 116504175
4-ethylsulfanyl-2-N-(oxolan-2-ylmethyl)butane-1,2-diamine (PubChem CID 116504175) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 4-ethylsulfanyl-2-N-(oxolan-2-ylmethyl)butane-1,2-diamine.
| Compound Name | 4-ethylsulfanyl-2-N-(oxolan-2-ylmethyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 116504175 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-ethylsulfanyl-2-N-(oxolan-2-ylmethyl)butane-1,2-diamine |
| SMILES | CCSCCC(CN)NCC1CCCO1 |
| InChI | InChI=1S/C11H24N2OS/c1-2-15-7-5-10(8-12)13-9-11-4-3-6-14-11/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | BTZQXAXVWDRCMR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|