C14H26N2S2 — CID 116504477
3-ethylsulfanyl-N-propan-2-yl-1-(4-propan-2-yl-1,3-thiazol-2-yl)propan-1-amine (PubChem CID 116504477) has the molecular formula C14H26N2S2 and a molecular weight of 286.51 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-propan-2-yl-1-(4-propan-2-yl-1,3-thiazol-2-yl)propan-1-amine.
| Compound Name | 3-ethylsulfanyl-N-propan-2-yl-1-(4-propan-2-yl-1,3-thiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 116504477 |
| Molecular Formula | C14H26N2S2 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-ethylsulfanyl-N-propan-2-yl-1-(4-propan-2-yl-1,3-thiazol-2-yl)propan-1-amine |
| SMILES | CCSCCC(NC(C)C)c1nc(C(C)C)cs1 |
| InChI | InChI=1S/C14H26N2S2/c1-6-17-8-7-12(15-11(4)5)14-16-13(9-18-14)10(2)3/h9-12,15H,6-8H2,1-5H3 |
| InChIKey | AOMAGNSTWNEUGS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|