C11H16ClNOS — CID 116504536
1-(3-chloro-4-pyridinyl)-4-ethylsulfanylbutan-2-ol (PubChem CID 116504536) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-4-ethylsulfanylbutan-2-ol.
| Compound Name | 1-(3-chloro-4-pyridinyl)-4-ethylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 116504536 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-4-ethylsulfanylbutan-2-ol |
| SMILES | CCSCCC(O)Cc1ccncc1Cl |
| InChI | InChI=1S/C11H16ClNOS/c1-2-15-6-4-10(14)7-9-3-5-13-8-11(9)12/h3,5,8,10,14H,2,4,6-7H2,1H3 |
| InChIKey | AXPFLNBLDGOFOL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|