About 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine
2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine (PubChem CID 116504995) has the molecular formula C9H16N2S2
and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine |
| PubChem CID | 116504995 |
| Molecular Formula | C9H16N2S2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine |
| SMILES | CCSCCc1nc(CC)sc1N |
| InChI | InChI=1S/C9H16N2S2/c1-3-8-11-7(9(10)13-8)5-6-12-4-2/h3-6,10H2,1-2H3 |
| InChIKey | UWAYBAOOIWTAAH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine?
The IUPAC name of 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine (CID 116504995) is 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine.
What is the SMILES notation for 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine?
The canonical SMILES for 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine is CCSCCc1nc(CC)sc1N.
What is the InChIKey of 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine?
The InChIKey is UWAYBAOOIWTAAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S2/c1-3-8-11-7(9(10)13-8)5-6-12-4-2/h3-6,10H2,1-2H3.
What are the key properties of 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine?
2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine has a molecular weight of 216.37 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine is sourced from PubChem (CID 116504995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).