C17H15F3O — CID 116505320
(4-cyclobutylphenyl)-(3,4,5-trifluorophenyl)methanol (PubChem CID 116505320) has the molecular formula C17H15F3O and a molecular weight of 292.30 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(3,4,5-trifluorophenyl)methanol.
| Compound Name | (4-cyclobutylphenyl)-(3,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 116505320 |
| Molecular Formula | C17H15F3O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (4-cyclobutylphenyl)-(3,4,5-trifluorophenyl)methanol |
| SMILES | OC(c1ccc(C2CCC2)cc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H15F3O/c18-14-8-13(9-15(19)16(14)20)17(21)12-6-4-11(5-7-12)10-2-1-3-10/h4-10,17,21H,1-3H2 |
| InChIKey | OWYQMBHIRRZHMG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|