C16H24O3 — CID 116505399
2-(4-cyclobutylphenyl)-4,4-dimethoxybutan-2-ol (PubChem CID 116505399) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(4-cyclobutylphenyl)-4,4-dimethoxybutan-2-ol.
| Compound Name | 2-(4-cyclobutylphenyl)-4,4-dimethoxybutan-2-ol |
|---|---|
| PubChem CID | 116505399 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-(4-cyclobutylphenyl)-4,4-dimethoxybutan-2-ol |
| SMILES | COC(CC(C)(O)c1ccc(C2CCC2)cc1)OC |
| InChI | InChI=1S/C16H24O3/c1-16(17,11-15(18-2)19-3)14-9-7-13(8-10-14)12-5-4-6-12/h7-10,12,15,17H,4-6,11H2,1-3H3 |
| InChIKey | QZYBFMNCBSTIHZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|