C16H22F3N — CID 116506010
1-(4-cyclobutylphenyl)-3,3,3-trifluoro-N-propylpropan-1-amine (PubChem CID 116506010) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-(4-cyclobutylphenyl)-3,3,3-trifluoro-N-propylpropan-1-amine.
| Compound Name | 1-(4-cyclobutylphenyl)-3,3,3-trifluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 116506010 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(4-cyclobutylphenyl)-3,3,3-trifluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(CC(F)(F)F)c1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C16H22F3N/c1-2-10-20-15(11-16(17,18)19)14-8-6-13(7-9-14)12-4-3-5-12/h6-9,12,15,20H,2-5,10-11H2,1H3 |
| InChIKey | HFCTYLXCVHFSPC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |