C9H15F3N2S — CID 116507917
3-cyclopropyl-1-propan-2-yl-1-(2,2,2-trifluoroethyl)thiourea (PubChem CID 116507917) has the molecular formula C9H15F3N2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 3-cyclopropyl-1-propan-2-yl-1-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 3-cyclopropyl-1-propan-2-yl-1-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 116507917 |
| Molecular Formula | C9H15F3N2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-cyclopropyl-1-propan-2-yl-1-(2,2,2-trifluoroethyl)thiourea |
| SMILES | CC(C)N(CC(F)(F)F)C(=S)NC1CC1 |
| InChI | InChI=1S/C9H15F3N2S/c1-6(2)14(5-9(10,11)12)8(15)13-7-3-4-7/h6-7H,3-5H2,1-2H3,(H,13,15) |
| InChIKey | MLHXGYUSVVSEGK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|