C8H15N5S — CID 116508871
3-ethyl-1-methyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]thiourea (PubChem CID 116508871) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]thiourea.
| Compound Name | 3-ethyl-1-methyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 116508871 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]thiourea |
| SMILES | CCNC(=S)N(C)Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C8H15N5S/c1-4-9-8(14)13(3)5-7-10-6(2)11-12-7/h4-5H2,1-3H3,(H,9,14)(H,10,11,12) |
| InChIKey | IGJGIOQVFRZYRL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|