About N-ethyl-3,5-dioxopiperazine-1-carbothioamide
N-ethyl-3,5-dioxopiperazine-1-carbothioamide (PubChem CID 116509206) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is N-ethyl-3,5-dioxopiperazine-1-carbothioamide.
Molecular Properties
| Compound Name | N-ethyl-3,5-dioxopiperazine-1-carbothioamide |
| PubChem CID | 116509206 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-ethyl-3,5-dioxopiperazine-1-carbothioamide |
| SMILES | CCNC(=S)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C7H11N3O2S/c1-2-8-7(13)10-3-5(11)9-6(12)4-10/h2-4H2,1H3,(H,8,13)(H,9,11,12) |
| InChIKey | FMKRWXNZVIHIJC-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,5-dioxopiperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,5-dioxopiperazine-1-carbothioamide?
The IUPAC name of N-ethyl-3,5-dioxopiperazine-1-carbothioamide (CID 116509206) is N-ethyl-3,5-dioxopiperazine-1-carbothioamide.
What is the SMILES notation for N-ethyl-3,5-dioxopiperazine-1-carbothioamide?
The canonical SMILES for N-ethyl-3,5-dioxopiperazine-1-carbothioamide is CCNC(=S)N1CC(=O)NC(=O)C1.
What is the InChIKey of N-ethyl-3,5-dioxopiperazine-1-carbothioamide?
The InChIKey is FMKRWXNZVIHIJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-2-8-7(13)10-3-5(11)9-6(12)4-10/h2-4H2,1H3,(H,8,13)(H,9,11,12).
What are the key properties of N-ethyl-3,5-dioxopiperazine-1-carbothioamide?
N-ethyl-3,5-dioxopiperazine-1-carbothioamide has a molecular weight of 201.25 g/mol, XLogP of -1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,5-dioxopiperazine-1-carbothioamide is sourced from PubChem (CID 116509206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).