C13H15N3O2S — CID 116509235
2-ethyl-3,5-dioxo-N-phenylpiperazine-1-carbothioamide (PubChem CID 116509235) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-ethyl-3,5-dioxo-N-phenylpiperazine-1-carbothioamide.
| Compound Name | 2-ethyl-3,5-dioxo-N-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 116509235 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-ethyl-3,5-dioxo-N-phenylpiperazine-1-carbothioamide |
| SMILES | CCC1C(=O)NC(=O)CN1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C13H15N3O2S/c1-2-10-12(18)15-11(17)8-16(10)13(19)14-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,14,19)(H,15,17,18) |
| InChIKey | JDHWKNDFNGJFHE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|