C15H27N3OS — CID 116509295
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-cyclohexylthiourea (PubChem CID 116509295) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-cyclohexylthiourea.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 116509295 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-cyclohexylthiourea |
| SMILES | S=C(NCC1CN2CCCC2CO1)NC1CCCCC1 |
| InChI | InChI=1S/C15H27N3OS/c20-15(17-12-5-2-1-3-6-12)16-9-14-10-18-8-4-7-13(18)11-19-14/h12-14H,1-11H2,(H2,16,17,20) |
| InChIKey | KNRBRSNNXRXATE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|