C11H22N2OS3 — CID 116510229
1-(1,4-dithian-2-ylmethyl)-3-(3-ethoxypropyl)thiourea (PubChem CID 116510229) has the molecular formula C11H22N2OS3 and a molecular weight of 294.51 g/mol. Its IUPAC name is 1-(1,4-dithian-2-ylmethyl)-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-(1,4-dithian-2-ylmethyl)-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 116510229 |
| Molecular Formula | C11H22N2OS3 |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(1,4-dithian-2-ylmethyl)-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)NCC1CSCCS1 |
| InChI | InChI=1S/C11H22N2OS3/c1-2-14-5-3-4-12-11(15)13-8-10-9-16-6-7-17-10/h10H,2-9H2,1H3,(H2,12,13,15) |
| InChIKey | PQFBMBXTRRJWGH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|