C10H18N4O — CID 116511400
1-amino-2-(furan-2-ylmethyl)-3-(2-methylpropyl)guanidine (PubChem CID 116511400) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-amino-2-(furan-2-ylmethyl)-3-(2-methylpropyl)guanidine.
| Compound Name | 1-amino-2-(furan-2-ylmethyl)-3-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 116511400 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-amino-2-(furan-2-ylmethyl)-3-(2-methylpropyl)guanidine |
| SMILES | CC(C)CN/C(=N\Cc1ccco1)NN |
| InChI | InChI=1S/C10H18N4O/c1-8(2)6-12-10(14-11)13-7-9-4-3-5-15-9/h3-5,8H,6-7,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | SRTZVEDOMZKREU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|