About 1-benzofuran-5-ol
1-benzofuran-5-ol (PubChem CID 11651159) has the molecular formula C8H6O2
and a molecular weight of 134.13 g/mol. Its IUPAC name is 1-benzofuran-5-ol.
Molecular Properties
| Compound Name | 1-benzofuran-5-ol |
| PubChem CID | 11651159 |
| Molecular Formula | C8H6O2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 1-benzofuran-5-ol |
| SMILES | Oc1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O2/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,9H |
| InChIKey | IZFOPMSVNDORMZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzofuran-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-5-ol?
The IUPAC name of 1-benzofuran-5-ol (CID 11651159) is 1-benzofuran-5-ol.
What is the SMILES notation for 1-benzofuran-5-ol?
The canonical SMILES for 1-benzofuran-5-ol is Oc1ccc2occc2c1.
What is the InChIKey of 1-benzofuran-5-ol?
The InChIKey is IZFOPMSVNDORMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,9H.
What are the key properties of 1-benzofuran-5-ol?
1-benzofuran-5-ol has a molecular weight of 134.13 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-5-ol is sourced from PubChem (CID 11651159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).