C5H9N3O2 — CID 11651171
4-propyl-1,2,4-triazolidine-3,5-dione (PubChem CID 11651171) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is 4-propyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-propyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 11651171 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 4-propyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C5H9N3O2/c1-2-3-8-4(9)6-7-5(8)10/h2-3H2,1H3,(H,6,9)(H,7,10) |
| InChIKey | JWEZTWSDZQJZQD-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |