C15H24N4O — CID 116511756
1-amino-2-(1-methoxypropan-2-yl)-3-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 116511756) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-amino-2-(1-methoxypropan-2-yl)-3-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 1-amino-2-(1-methoxypropan-2-yl)-3-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 116511756 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-amino-2-(1-methoxypropan-2-yl)-3-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | COCC(C)/N=C(\NN)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H24N4O/c1-11(10-20-2)17-15(19-16)18-14-9-5-7-12-6-3-4-8-13(12)14/h5,7,9,11H,3-4,6,8,10,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | NORDHQXTDYXNQG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|