C10H14BrFN4 — CID 116513335
1-amino-3-(5-bromo-2-fluorophenyl)-2-propylguanidine (PubChem CID 116513335) has the molecular formula C10H14BrFN4 and a molecular weight of 289.15 g/mol. Its IUPAC name is 1-amino-3-(5-bromo-2-fluorophenyl)-2-propylguanidine.
| Compound Name | 1-amino-3-(5-bromo-2-fluorophenyl)-2-propylguanidine |
|---|---|
| PubChem CID | 116513335 |
| Molecular Formula | C10H14BrFN4 |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-amino-3-(5-bromo-2-fluorophenyl)-2-propylguanidine |
| SMILES | CCC/N=C(\NN)Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C10H14BrFN4/c1-2-5-14-10(16-13)15-9-6-7(11)3-4-8(9)12/h3-4,6H,2,5,13H2,1H3,(H2,14,15,16) |
| InChIKey | KIGZZGVURSFYTL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|