C12H21N5 — CID 116513513
3-amino-1-methyl-2-propyl-1-(2-pyridin-4-ylethyl)guanidine (PubChem CID 116513513) has the molecular formula C12H21N5 and a molecular weight of 235.34 g/mol. Its IUPAC name is 3-amino-1-methyl-2-propyl-1-(2-pyridin-4-ylethyl)guanidine.
| Compound Name | 3-amino-1-methyl-2-propyl-1-(2-pyridin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 116513513 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 3-amino-1-methyl-2-propyl-1-(2-pyridin-4-ylethyl)guanidine |
| SMILES | CCC/N=C(\NN)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C12H21N5/c1-3-7-15-12(16-13)17(2)10-6-11-4-8-14-9-5-11/h4-5,8-9H,3,6-7,10,13H2,1-2H3,(H,15,16) |
| InChIKey | UGZWRNIBYMQLSP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|