C11H20N4S — CID 116513897
1-amino-3-propan-2-yl-2-(1-thiophen-2-ylpropyl)guanidine (PubChem CID 116513897) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 1-amino-3-propan-2-yl-2-(1-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-amino-3-propan-2-yl-2-(1-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 116513897 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-amino-3-propan-2-yl-2-(1-thiophen-2-ylpropyl)guanidine |
| SMILES | CCC(/N=C(/NN)NC(C)C)c1cccs1 |
| InChI | InChI=1S/C11H20N4S/c1-4-9(10-6-5-7-16-10)14-11(15-12)13-8(2)3/h5-9H,4,12H2,1-3H3,(H2,13,14,15) |
| InChIKey | OHBZWPXSGQISGI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|