C10H18N6 — CID 116514874
1-amino-2-cyclopropyl-3-(1-pyrazol-1-ylpropan-2-yl)guanidine (PubChem CID 116514874) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is 1-amino-2-cyclopropyl-3-(1-pyrazol-1-ylpropan-2-yl)guanidine.
| Compound Name | 1-amino-2-cyclopropyl-3-(1-pyrazol-1-ylpropan-2-yl)guanidine |
|---|---|
| PubChem CID | 116514874 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-amino-2-cyclopropyl-3-(1-pyrazol-1-ylpropan-2-yl)guanidine |
| SMILES | CC(Cn1cccn1)N/C(=N/C1CC1)NN |
| InChI | InChI=1S/C10H18N6/c1-8(7-16-6-2-5-12-16)13-10(15-11)14-9-3-4-9/h2,5-6,8-9H,3-4,7,11H2,1H3,(H2,13,14,15) |
| InChIKey | AJNBDVWZPXFYBX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|