C11H12O5 — CID 11651490
[(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate (PubChem CID 11651490) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is [(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate.
| Compound Name | [(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 11651490 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | [(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate |
| SMILES | C=C[C@H]1O[C@H]2C=CC(=O)O[C@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H12O5/c1-3-7-10(14-6(2)12)11-8(15-7)4-5-9(13)16-11/h3-5,7-8,10-11H,1H2,2H3/t7-,8+,10+,11-/m1/s1 |
| InChIKey | RAWMLEVFPGVBPK-YKDSUIRESA-N |
| XLogP | 0.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|