About 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane
3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane (PubChem CID 11651516) has the molecular formula C13H26OSi
and a molecular weight of 226.44 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane.
Molecular Properties
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane |
| PubChem CID | 11651516 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane |
| SMILES | C=CC(C)(CCC=C(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-8-13(4,14-15(5,6)7)11-9-10-12(2)3/h8,10H,1,9,11H2,2-7H3 |
| InChIKey | GSRJPHNVKPGXHU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane?
The IUPAC name of 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane (CID 11651516) is 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane.
What is the SMILES notation for 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane?
The canonical SMILES for 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane is C=CC(C)(CCC=C(C)C)O[Si](C)(C)C.
What is the InChIKey of 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane?
The InChIKey is GSRJPHNVKPGXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OSi/c1-8-13(4,14-15(5,6)7)11-9-10-12(2)3/h8,10H,1,9,11H2,2-7H3.
What are the key properties of 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane?
3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane has a molecular weight of 226.44 g/mol, XLogP of 4.53, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylocta-1,6-dien-3-yloxy(trimethyl)silane is sourced from PubChem (CID 11651516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).