C13H20N4S — CID 116515930
1-amino-3-phenyl-2-(thian-2-ylmethyl)guanidine (PubChem CID 116515930) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 1-amino-3-phenyl-2-(thian-2-ylmethyl)guanidine.
| Compound Name | 1-amino-3-phenyl-2-(thian-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 116515930 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-amino-3-phenyl-2-(thian-2-ylmethyl)guanidine |
| SMILES | NN/C(=N\CC1CCCCS1)Nc1ccccc1 |
| InChI | InChI=1S/C13H20N4S/c14-17-13(16-11-6-2-1-3-7-11)15-10-12-8-4-5-9-18-12/h1-3,6-7,12H,4-5,8-10,14H2,(H2,15,16,17) |
| InChIKey | GYRXVMTYEMFIEQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|