C15H23FN4 — CID 116515958
1-amino-3-cyclopentyl-2-[(4-fluoro-3,5-dimethylphenyl)methyl]guanidine (PubChem CID 116515958) has the molecular formula C15H23FN4 and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-[(4-fluoro-3,5-dimethylphenyl)methyl]guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-[(4-fluoro-3,5-dimethylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 116515958 |
| Molecular Formula | C15H23FN4 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-[(4-fluoro-3,5-dimethylphenyl)methyl]guanidine |
| SMILES | Cc1cc(C/N=C(\NN)NC2CCCC2)cc(C)c1F |
| InChI | InChI=1S/C15H23FN4/c1-10-7-12(8-11(2)14(10)16)9-18-15(20-17)19-13-5-3-4-6-13/h7-8,13H,3-6,9,17H2,1-2H3,(H2,18,19,20) |
| InChIKey | ZOISHWHISSPEQZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|