C15H21N — CID 116517534
1-cyclobutyl-N-methyl-1-(2-phenylcyclopropyl)methanamine (PubChem CID 116517534) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-cyclobutyl-N-methyl-1-(2-phenylcyclopropyl)methanamine.
| Compound Name | 1-cyclobutyl-N-methyl-1-(2-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 116517534 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-cyclobutyl-N-methyl-1-(2-phenylcyclopropyl)methanamine |
| SMILES | CNC(C1CCC1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C15H21N/c1-16-15(12-8-5-9-12)14-10-13(14)11-6-3-2-4-7-11/h2-4,6-7,12-16H,5,8-10H2,1H3 |
| InChIKey | AWTQASJVLHCYAQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |