About 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene
3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene (PubChem CID 11651789) has the molecular formula C10H12BrNS
and a molecular weight of 258.18 g/mol. Its IUPAC name is 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene.
Molecular Properties
| Compound Name | 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene |
| PubChem CID | 11651789 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene |
| SMILES | Brc1sc2c3c1CCC3CNCC2 |
| InChI | InChI=1S/C10H12BrNS/c11-10-7-2-1-6-5-12-4-3-8(13-10)9(6)7/h6,12H,1-5H2 |
| InChIKey | ABXMRAHPWLFTND-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene?
The IUPAC name of 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene (CID 11651789) is 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene.
What is the SMILES notation for 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene?
The canonical SMILES for 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene is Brc1sc2c3c1CCC3CNCC2.
What is the InChIKey of 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene?
The InChIKey is ABXMRAHPWLFTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNS/c11-10-7-2-1-6-5-12-4-3-8(13-10)9(6)7/h6,12H,1-5H2.
What are the key properties of 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene?
3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene has a molecular weight of 258.18 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-thia-9-azatricyclo[5.4.1.04,12]dodeca-1(12),3-diene is sourced from PubChem (CID 11651789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).