About 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine
2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine (PubChem CID 11651818) has the molecular formula C9H7F3N4S
and a molecular weight of 260.24 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine |
| PubChem CID | 11651818 |
| Molecular Formula | C9H7F3N4S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C9H7F3N4S/c10-9(11,12)4-1-2-6-5(3-4)15-8(17-6)16-7(13)14/h1-3H,(H4,13,14,15,16) |
| InChIKey | LTTQMCLAWPKCKV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine?
The IUPAC name of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine (CID 11651818) is 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine.
What is the SMILES notation for 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine?
The canonical SMILES for 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine is NC(N)=Nc1nc2cc(C(F)(F)F)ccc2s1.
What is the InChIKey of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine?
The InChIKey is LTTQMCLAWPKCKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N4S/c10-9(11,12)4-1-2-6-5(3-4)15-8(17-6)16-7(13)14/h1-3H,(H4,13,14,15,16).
What are the key properties of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine?
2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine has a molecular weight of 260.24 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]guanidine is sourced from PubChem (CID 11651818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).