C14H20Cl2N2 — CID 116519073
2,4-dichloro-5-[(2-propylpiperidin-1-yl)methyl]pyridine (PubChem CID 116519073) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-propylpiperidin-1-yl)methyl]pyridine.
| Compound Name | 2,4-dichloro-5-[(2-propylpiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 116519073 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2,4-dichloro-5-[(2-propylpiperidin-1-yl)methyl]pyridine |
| SMILES | CCCC1CCCCN1Cc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2/c1-2-5-12-6-3-4-7-18(12)10-11-9-17-14(16)8-13(11)15/h8-9,12H,2-7,10H2,1H3 |
| InChIKey | QRKUTSISZGSHIY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|