About 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one
3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one (PubChem CID 116519285) has the molecular formula C11H6BrCl2N3O3
and a molecular weight of 379.00 g/mol. Its IUPAC name is 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one.
Molecular Properties
| Compound Name | 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one |
| PubChem CID | 116519285 |
| Molecular Formula | C11H6BrCl2N3O3 |
| Molecular Weight | 379.00 g/mol |
| Exact Mass | 376.90 |
| IUPAC Name | 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one |
| SMILES | O=c1c(Br)cn(Cc2cnc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H6BrCl2N3O3/c12-7-4-16(5-9(11(7)18)17(19)20)3-6-2-15-10(14)1-8(6)13/h1-2,4-5H,3H2 |
| InChIKey | FGIONQQLYYEXIJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one?
The IUPAC name of 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one (CID 116519285) is 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one.
What is the SMILES notation for 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one?
The canonical SMILES for 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one is O=c1c(Br)cn(Cc2cnc(Cl)cc2Cl)cc1[N+](=O)[O-].
What is the InChIKey of 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one?
The InChIKey is FGIONQQLYYEXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrCl2N3O3/c12-7-4-16(5-9(11(7)18)17(19)20)3-6-2-15-10(14)1-8(6)13/h1-2,4-5H,3H2.
What are the key properties of 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one?
3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one has a molecular weight of 379.00 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-[(4,6-dichloro-3-pyridinyl)methyl]-5-nitropyridin-4-one is sourced from PubChem (CID 116519285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).