About 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one
3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one (PubChem CID 116519291) has the molecular formula C11H6Br2Cl2N2O
and a molecular weight of 412.90 g/mol. Its IUPAC name is 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one.
Molecular Properties
| Compound Name | 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one |
| PubChem CID | 116519291 |
| Molecular Formula | C11H6Br2Cl2N2O |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 409.82 |
| IUPAC Name | 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one |
| SMILES | O=c1c(Br)cc(Br)cn1Cc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Br2Cl2N2O/c12-7-1-8(13)11(18)17(5-7)4-6-3-16-10(15)2-9(6)14/h1-3,5H,4H2 |
| InChIKey | WDJWIHDREYYNHN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one?
The IUPAC name of 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one (CID 116519291) is 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one.
What is the SMILES notation for 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one?
The canonical SMILES for 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one is O=c1c(Br)cc(Br)cn1Cc1cnc(Cl)cc1Cl.
What is the InChIKey of 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one?
The InChIKey is WDJWIHDREYYNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Br2Cl2N2O/c12-7-1-8(13)11(18)17(5-7)4-6-3-16-10(15)2-9(6)14/h1-3,5H,4H2.
What are the key properties of 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one?
3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one has a molecular weight of 412.90 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-1-[(4,6-dichloro-3-pyridinyl)methyl]pyridin-2-one is sourced from PubChem (CID 116519291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).