C15H15Cl2N3 — CID 116519857
5-[(4,6-dichloro-3-pyridinyl)methyl]-1,2,3,4-tetrahydro-1,5-benzodiazepine (PubChem CID 116519857) has the molecular formula C15H15Cl2N3 and a molecular weight of 308.21 g/mol. Its IUPAC name is 5-[(4,6-dichloro-3-pyridinyl)methyl]-1,2,3,4-tetrahydro-1,5-benzodiazepine.
| Compound Name | 5-[(4,6-dichloro-3-pyridinyl)methyl]-1,2,3,4-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 116519857 |
| Molecular Formula | C15H15Cl2N3 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-[(4,6-dichloro-3-pyridinyl)methyl]-1,2,3,4-tetrahydro-1,5-benzodiazepine |
| SMILES | Clc1cc(Cl)c(CN2CCCNc3ccccc32)cn1 |
| InChI | InChI=1S/C15H15Cl2N3/c16-12-8-15(17)19-9-11(12)10-20-7-3-6-18-13-4-1-2-5-14(13)20/h1-2,4-5,8-9,18H,3,6-7,10H2 |
| InChIKey | DWNXUWHPJZNCFF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|