About (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one
(2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one (PubChem CID 11652068) has the molecular formula C17H15NO3
and a molecular weight of 281.31 g/mol. Its IUPAC name is (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one.
Molecular Properties
| Compound Name | (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one |
| PubChem CID | 11652068 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)/C(=C\c1ccncc1)C2 |
| InChI | InChI=1S/C17H15NO3/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2/h3-7,9-10H,8H2,1-2H3/b13-7- |
| InChIKey | SUVQWDLUAIFZKM-QPEQYQDCSA-N |
| XLogP | 2.92 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one?
The IUPAC name of (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one (CID 11652068) is (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one.
What is the SMILES notation for (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one?
The canonical SMILES for (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one is COc1cc2c(cc1OC)C(=O)/C(=C\c1ccncc1)C2.
What is the InChIKey of (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one?
The InChIKey is SUVQWDLUAIFZKM-QPEQYQDCSA-N. The full InChI is InChI=1S/C17H15NO3/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2/h3-7,9-10H,8H2,1-2H3/b13-7-.
What are the key properties of (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one?
(2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one has a molecular weight of 281.31 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one is sourced from PubChem (CID 11652068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).