C13H18O7 — CID 11652149
methyl (1S,2S,6S,9R,11S)-11-formyl-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate (PubChem CID 11652149) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl (1S,2S,6S,9R,11S)-11-formyl-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate.
| Compound Name | methyl (1S,2S,6S,9R,11S)-11-formyl-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
|---|---|
| PubChem CID | 11652149 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl (1S,2S,6S,9R,11S)-11-formyl-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
| SMILES | COC(=O)[C@@]1(C=O)C[C@H]2OC[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C13H18O7/c1-12(2)18-8-5-17-7-4-13(6-14,11(15)16-3)20-9(7)10(8)19-12/h6-10H,4-5H2,1-3H3/t7-,8+,9+,10+,13+/m1/s1 |
| InChIKey | BRQWDWOGQLDLFJ-VQAIZDJRSA-N |
| XLogP | -0.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|