About 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid
3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid (PubChem CID 116522214) has the molecular formula C16H24N2O3
and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid |
| PubChem CID | 116522214 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid |
| SMILES | CC1(C)CCC(CN(CCC(=O)O)c2ccccc2N)O1 |
| InChI | InChI=1S/C16H24N2O3/c1-16(2)9-7-12(21-16)11-18(10-8-15(19)20)14-6-4-3-5-13(14)17/h3-6,12H,7-11,17H2,1-2H3,(H,19,20) |
| InChIKey | WHUPHSRKXLLJCH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid?
The IUPAC name of 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid (CID 116522214) is 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid.
What is the SMILES notation for 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid?
The canonical SMILES for 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid is CC1(C)CCC(CN(CCC(=O)O)c2ccccc2N)O1.
What is the InChIKey of 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid?
The InChIKey is WHUPHSRKXLLJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3/c1-16(2)9-7-12(21-16)11-18(10-8-15(19)20)14-6-4-3-5-13(14)17/h3-6,12H,7-11,17H2,1-2H3,(H,19,20).
What are the key properties of 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid?
3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid has a molecular weight of 292.38 g/mol, XLogP of 2.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-amino-N-[(5,5-dimethyloxolan-2-yl)methyl]anilino]propanoic acid is sourced from PubChem (CID 116522214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).