About azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile
azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile (PubChem CID 11652231) has the molecular formula C15H12N6O
and a molecular weight of 292.30 g/mol. Its IUPAC name is azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile.
Molecular Properties
| Compound Name | azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile |
| PubChem CID | 11652231 |
| Molecular Formula | C15H12N6O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile |
| SMILES | Cc1ccc(-n2cnc3c(C#N)c(C#N)c(=O)[nH]c32)cc1.N |
| InChI | InChI=1S/C15H9N5O.H3N/c1-9-2-4-10(5-3-9)20-8-18-13-11(6-16)12(7-17)15(21)19-14(13)20;/h2-5,8H,1H3,(H,19,21);1H3 |
| InChIKey | AESZPKLGUFVNGH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile?
The IUPAC name of azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile (CID 11652231) is azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile.
What is the SMILES notation for azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile?
The canonical SMILES for azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile is Cc1ccc(-n2cnc3c(C#N)c(C#N)c(=O)[nH]c32)cc1.N.
What is the InChIKey of azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile?
The InChIKey is AESZPKLGUFVNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N5O.H3N/c1-9-2-4-10(5-3-9)20-8-18-13-11(6-16)12(7-17)15(21)19-14(13)20;/h2-5,8H,1H3,(H,19,21);1H3.
What are the key properties of azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile?
azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile has a molecular weight of 292.30 g/mol, XLogP of 1.93, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-(4-methylphenyl)-5-oxo-4H-imidazo[4,5-b]pyridine-6,7-dicarbonitrile is sourced from PubChem (CID 11652231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).