1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid

C16H19NO3 — CID 116522323

IUPAC1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid
SMILESCC1(C)CCC(Cn2c(C(=O)O)cc3ccccc32)O1
InChIInChI=1S/C16H19NO3/c1-16(2)8-7-12(20-16)10-17-13-6-4-3-5-11(13)9-14(17)15(18)19/h3-6,9,12H,7-8,10H2,1-2H3,(H,18,19)
InChIKeySXWQNUYZQSQYOU-UHFFFAOYSA-N
MW273.33 g/mol
LogP3.30
Rot. Bonds3

About 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid

1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid (PubChem CID 116522323) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid.

Molecular Properties

Compound Name1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid
PubChem CID116522323
Molecular FormulaC16H19NO3
Molecular Weight273.33 g/mol
Exact Mass273.14
IUPAC Name1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid
SMILESCC1(C)CCC(Cn2c(C(=O)O)cc3ccccc32)O1
InChIInChI=1S/C16H19NO3/c1-16(2)8-7-12(20-16)10-17-13-6-4-3-5-11(13)9-14(17)15(18)19/h3-6,9,12H,7-8,10H2,1-2H3,(H,18,19)
InChIKeySXWQNUYZQSQYOU-UHFFFAOYSA-N
XLogP3.30
TPSA51.46 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.33
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid?
The IUPAC name of 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid (CID 116522323) is 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid.
What is the SMILES notation for 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid?
The canonical SMILES for 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid is CC1(C)CCC(Cn2c(C(=O)O)cc3ccccc32)O1.
What is the InChIKey of 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid?
The InChIKey is SXWQNUYZQSQYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-16(2)8-7-12(20-16)10-17-13-6-4-3-5-11(13)9-14(17)15(18)19/h3-6,9,12H,7-8,10H2,1-2H3,(H,18,19).
What are the key properties of 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid?
1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid has a molecular weight of 273.33 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-2-carboxylic acid is sourced from PubChem (CID 116522323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).