C15H21BrO3 — CID 116522372
5-[[2-(bromomethyl)-4-methoxyphenoxy]methyl]-2,2-dimethyloxolane (PubChem CID 116522372) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is 5-[[2-(bromomethyl)-4-methoxyphenoxy]methyl]-2,2-dimethyloxolane.
| Compound Name | 5-[[2-(bromomethyl)-4-methoxyphenoxy]methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116522372 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-[[2-(bromomethyl)-4-methoxyphenoxy]methyl]-2,2-dimethyloxolane |
| SMILES | COc1ccc(OCC2CCC(C)(C)O2)c(CBr)c1 |
| InChI | InChI=1S/C15H21BrO3/c1-15(2)7-6-13(19-15)10-18-14-5-4-12(17-3)8-11(14)9-16/h4-5,8,13H,6-7,9-10H2,1-3H3 |
| InChIKey | CRDNXDWSHDPTIB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|