About 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid
3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid (PubChem CID 116522433) has the molecular formula C15H20O5S
and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid |
| PubChem CID | 116522433 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1S(=O)(=O)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C15H20O5S/c1-10-12(14(16)17)5-4-6-13(10)21(18,19)9-11-7-8-15(2,3)20-11/h4-6,11H,7-9H2,1-3H3,(H,16,17) |
| InChIKey | YZRCCQPLCIIOQY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid?
The IUPAC name of 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid (CID 116522433) is 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid.
What is the SMILES notation for 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid?
The canonical SMILES for 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid is Cc1c(C(=O)O)cccc1S(=O)(=O)CC1CCC(C)(C)O1.
What is the InChIKey of 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid?
The InChIKey is YZRCCQPLCIIOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O5S/c1-10-12(14(16)17)5-4-6-13(10)21(18,19)9-11-7-8-15(2,3)20-11/h4-6,11H,7-9H2,1-3H3,(H,16,17).
What are the key properties of 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid?
3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid has a molecular weight of 312.39 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-2-methylbenzoic acid is sourced from PubChem (CID 116522433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).