About [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol
[2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol (PubChem CID 116522844) has the molecular formula C12H20N2O2S
and a molecular weight of 256.37 g/mol. Its IUPAC name is [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol |
| PubChem CID | 116522844 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol |
| SMILES | Cn1c(CO)cnc1SCC1CCC(C)(C)O1 |
| InChI | InChI=1S/C12H20N2O2S/c1-12(2)5-4-10(16-12)8-17-11-13-6-9(7-15)14(11)3/h6,10,15H,4-5,7-8H2,1-3H3 |
| InChIKey | KFGFTHOCNOBOOU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The IUPAC name of [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol (CID 116522844) is [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol.
What is the SMILES notation for [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The canonical SMILES for [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol is Cn1c(CO)cnc1SCC1CCC(C)(C)O1.
What is the InChIKey of [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The InChIKey is KFGFTHOCNOBOOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S/c1-12(2)5-4-10(16-12)8-17-11-13-6-9(7-15)14(11)3/h6,10,15H,4-5,7-8H2,1-3H3.
What are the key properties of [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
[2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol has a molecular weight of 256.37 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol is sourced from PubChem (CID 116522844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).