About 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine
5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine (PubChem CID 11652317) has the molecular formula C12H19FN6O2
and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine |
| PubChem CID | 11652317 |
| Molecular Formula | C12H19FN6O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine |
| SMILES | Fc1cnc(NN2CCOCC2)nc1NN1CCOCC1 |
| InChI | InChI=1S/C12H19FN6O2/c13-10-9-14-12(17-19-3-7-21-8-4-19)15-11(10)16-18-1-5-20-6-2-18/h9H,1-8H2,(H2,14,15,16,17) |
| InChIKey | YMIRKYHHYRQXIK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine?
The IUPAC name of 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine (CID 11652317) is 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine?
The canonical SMILES for 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine is Fc1cnc(NN2CCOCC2)nc1NN1CCOCC1.
What is the InChIKey of 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine?
The InChIKey is YMIRKYHHYRQXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FN6O2/c13-10-9-14-12(17-19-3-7-21-8-4-19)15-11(10)16-18-1-5-20-6-2-18/h9H,1-8H2,(H2,14,15,16,17).
What are the key properties of 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine?
5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine has a molecular weight of 298.32 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-N,4-N-dimorpholin-4-ylpyrimidine-2,4-diamine is sourced from PubChem (CID 11652317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).