About 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one
3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one (PubChem CID 116523189) has the molecular formula C12H17IN2O2
and a molecular weight of 348.18 g/mol. Its IUPAC name is 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one |
| PubChem CID | 116523189 |
| Molecular Formula | C12H17IN2O2 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(CC2CCC(C)(C)O2)c(=O)c1I |
| InChI | InChI=1S/C12H17IN2O2/c1-8-10(13)11(16)15(7-14-8)6-9-4-5-12(2,3)17-9/h7,9H,4-6H2,1-3H3 |
| InChIKey | CYOIUMWPEPVEQM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one?
The IUPAC name of 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one (CID 116523189) is 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one.
What is the SMILES notation for 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one?
The canonical SMILES for 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one is Cc1ncn(CC2CCC(C)(C)O2)c(=O)c1I.
What is the InChIKey of 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one?
The InChIKey is CYOIUMWPEPVEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17IN2O2/c1-8-10(13)11(16)15(7-14-8)6-9-4-5-12(2,3)17-9/h7,9H,4-6H2,1-3H3.
What are the key properties of 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one?
3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one has a molecular weight of 348.18 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,5-dimethyloxolan-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one is sourced from PubChem (CID 116523189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).