C20H29NO — CID 11652341
(6S,10S,11R)-10-methyl-1-(4-methylpent-3-enyl)-11-prop-1-ynyl-2-azaspiro[5.5]undec-1-en-9-one (PubChem CID 11652341) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (6S,10S,11R)-10-methyl-1-(4-methylpent-3-enyl)-11-prop-1-ynyl-2-azaspiro[5.5]undec-1-en-9-one.
| Compound Name | (6S,10S,11R)-10-methyl-1-(4-methylpent-3-enyl)-11-prop-1-ynyl-2-azaspiro[5.5]undec-1-en-9-one |
|---|---|
| PubChem CID | 11652341 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (6S,10S,11R)-10-methyl-1-(4-methylpent-3-enyl)-11-prop-1-ynyl-2-azaspiro[5.5]undec-1-en-9-one |
| SMILES | CC#C[C@H]1[C@H](C)C(=O)CC[C@@]12CCCN=C2CCC=C(C)C |
| InChI | InChI=1S/C20H29NO/c1-5-8-17-16(4)18(22)11-13-20(17)12-7-14-21-19(20)10-6-9-15(2)3/h9,16-17H,6-7,10-14H2,1-4H3/t16-,17-,20-/m0/s1 |
| InChIKey | UCZWTSUOUMWXHQ-ZWOKBUDYSA-N |
| XLogP | 4.59 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|