C14H28ClNO — CID 116523973
N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]pentan-3-amine (PubChem CID 116523973) has the molecular formula C14H28ClNO and a molecular weight of 261.84 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]pentan-3-amine.
| Compound Name | N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 116523973 |
| Molecular Formula | C14H28ClNO |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]pentan-3-amine |
| SMILES | CCC(CC)N(CCCl)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C14H28ClNO/c1-5-12(6-2)16(10-9-15)11-13-7-8-14(3,4)17-13/h12-13H,5-11H2,1-4H3 |
| InChIKey | WGVDOUGYYFRVQY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|