About (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine
(E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine (PubChem CID 11652410) has the molecular formula C18H29NOSi
and a molecular weight of 303.52 g/mol. Its IUPAC name is (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine |
| PubChem CID | 11652410 |
| Molecular Formula | C18H29NOSi |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine |
| SMILES | CC(C)[Si](O/N=C1\CCc2ccccc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29NOSi/c1-13(2)21(14(3)4,15(5)6)20-19-18-12-11-16-9-7-8-10-17(16)18/h7-10,13-15H,11-12H2,1-6H3/b19-18+ |
| InChIKey | IVQRPUFQOBUFPG-VHEBQXMUSA-N |
| XLogP | 5.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine?
The IUPAC name of (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine (CID 11652410) is (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine.
What is the SMILES notation for (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine?
The canonical SMILES for (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine is CC(C)[Si](O/N=C1\CCc2ccccc21)(C(C)C)C(C)C.
What is the InChIKey of (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine?
The InChIKey is IVQRPUFQOBUFPG-VHEBQXMUSA-N. The full InChI is InChI=1S/C18H29NOSi/c1-13(2)21(14(3)4,15(5)6)20-19-18-12-11-16-9-7-8-10-17(16)18/h7-10,13-15H,11-12H2,1-6H3/b19-18+.
What are the key properties of (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine?
(E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine has a molecular weight of 303.52 g/mol, XLogP of 5.53, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine is sourced from PubChem (CID 11652410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).