C18H29NOSi — CID 11652410
(E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine (PubChem CID 11652410) has the molecular formula C18H29NOSi and a molecular weight of 303.52 g/mol. Its IUPAC name is (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine.
| Compound Name | (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 11652410 |
| Molecular Formula | C18H29NOSi |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (E)-N-tri(propan-2-yl)silyloxy-2,3-dihydroinden-1-imine |
| SMILES | CC(C)[Si](O/N=C1\CCc2ccccc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29NOSi/c1-13(2)21(14(3)4,15(5)6)20-19-18-12-11-16-9-7-8-10-17(16)18/h7-10,13-15H,11-12H2,1-6H3/b19-18+ |
| InChIKey | IVQRPUFQOBUFPG-VHEBQXMUSA-N |
| XLogP | 5.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|